CAS 610791-42-9 appears in our catalog under these names: 1-(3,5-Difluorophenyl)cyclopentane-1-carboxylic acid, 95%, 1-(3,5-Difluorophenyl)cyclopentane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(3,5-difluorophenyl)cyclopentane-1-carboxylic acid (CAS 610791-42-9) is a chemical compound with the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. IUPAC name: 1-(3,5-difluorophenyl)cyclopentane-1-carboxylic acid. InChIKey: LYNZEVPXFDEQTD-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O2 |
|---|---|
| Molecular weight | 226.22 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | LYNZEVPXFDEQTD-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC(=CC(=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)