CAS 832740-29-1 is the registry number for 1-(3,4-Dimethylphenyl)-4,4-difluorobutane-1,3-dione. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(3,4-dimethylphenyl)-4,4-difluorobutane-1,3-dione (CAS 832740-29-1) is a chemical compound with the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)-4,4-difluorobutane-1,3-dione. InChIKey: IALCAMREMCZMLO-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O2 |
|---|---|
| Molecular weight | 226.22 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)-4,4-difluorobutane-1,3-dione |
| InChIKey | IALCAMREMCZMLO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)CC(=O)C(F)F)C |
Computed by PubChem (NCBI)