CAS 832741-19-2 is the registry number for 1-(4-Ethylphenyl)-4,4-difluorobutane-1,3-dione. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(4-ethylphenyl)-4,4-difluorobutane-1,3-dione (CAS 832741-19-2) is a chemical compound with the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. IUPAC name: 1-(4-ethylphenyl)-4,4-difluorobutane-1,3-dione. InChIKey: NZKGGXZCRXAKHD-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O2 |
|---|---|
| Molecular weight | 226.22 g/mol |
| IUPAC name | 1-(4-ethylphenyl)-4,4-difluorobutane-1,3-dione |
| InChIKey | NZKGGXZCRXAKHD-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C(=O)CC(=O)C(F)F |
Computed by PubChem (NCBI)