Products 99764-31-5

CAS 99764-31-5 is the registry number for Ethyl 2-benzyl-3,3-difluoroacrylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-benzyl-3,3-difluoroprop-2-enoate (CAS 99764-31-5) is a chemical compound with the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. IUPAC name: ethyl 2-benzyl-3,3-difluoroprop-2-enoate. InChIKey: WNLZPPWOXDSFRD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12F2O2
Molecular weight226.22 g/mol
IUPAC nameethyl 2-benzyl-3,3-difluoroprop-2-enoate
InChIKeyWNLZPPWOXDSFRD-UHFFFAOYSA-N
SMILESCCOC(=O)C(=C(F)F)CC1=CC=CC=C1

Computed by PubChem (NCBI)