CAS 1260893-49-9 is the registry number for Aripiprazole Impurity 35. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-amino-2,3-dichlorophenyl)ethanone (CAS 1260893-49-9) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: 1-(4-amino-2,3-dichlorophenyl)ethanone. InChIKey: POCXNEWMDGFBEH-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 1-(4-amino-2,3-dichlorophenyl)ethanone |
| InChIKey | POCXNEWMDGFBEH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)N)Cl)Cl |
Computed by PubChem (NCBI)