Products 1261170-77-7
CAS 1261170-77-7 appears in our catalog under these names: Aldicarb-(N-methyl-13C,D3 carbamoyl-13C) Sulfoxide, 13C2,D3-Aldicarb-sulfoxide, ISO 17034 RM, 13C2,D3-Aldicarb-sulfoxide, 100 µg/ml in Acetonitrile, ISO 17034 CRM, Aldicarb-(N-methyl-13C,d3, carbamoyl-13C. Offered by: TRC, HPC Standards, Sigma-Aldrich. Available pack sizes: 200mg, 5mg, 1ml, 1MG.
[(E)-(2-methyl-2-methylsulfinylpropylidene)amino] N-(trideuterio(113C)methyl)carbamate (CAS 1261170-77-7) is a chemical compound with the molecular formula C7H14N2O3S and a molecular weight of 211.27 g/mol. IUPAC name: [(E)-(2-methyl-2-methylsulfinylpropylidene)amino] N-(trideuterio(113C)methyl)carbamate. InChIKey: BXPMAGSOWXBZHS-FONWFMSDSA-N.
| Molecular formula | C7H14N2O3S |
|---|---|
| Molecular weight | 211.27 g/mol |
| IUPAC name | [(E)-(2-methyl-2-methylsulfinylpropylidene)amino] N-(trideuterio(113C)methyl)carbamate |
| InChIKey | BXPMAGSOWXBZHS-FONWFMSDSA-N |
| SMILES | [2H][13C]([2H])([2H])N[13C](=O)O/N=C/C(C)(C)S(=O)C |
Computed by PubChem (NCBI)