Products 1261468-23-8
CAS 1261468-23-8 is the registry number for 2-Chloro-6-methoxypyridine-4-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-6-methoxypyridine-4-sulfonyl chloride (CAS 1261468-23-8) is a chemical compound with the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. IUPAC name: 2-chloro-6-methoxypyridine-4-sulfonyl chloride. InChIKey: MFYUIMJOXTWTCV-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO3S |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | 2-chloro-6-methoxypyridine-4-sulfonyl chloride |
| InChIKey | MFYUIMJOXTWTCV-UHFFFAOYSA-N |
| SMILES | COC1=NC(=CC(=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)