CAS 75720-93-3 appears in our catalog under these names: 6-Chloro-5-methoxypyridine-3-sulfonyl chloride, 6-Chloro-5-methoxypyridine-3-sulfonyl chloride 95%, 6-Chloro-5-methoxypyridine-3-sulfonyl chloride, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
6-chloro-5-methoxypyridine-3-sulfonyl chloride (CAS 75720-93-3) is a chemical compound with the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. IUPAC name: 6-chloro-5-methoxypyridine-3-sulfonyl chloride. InChIKey: CZEMPZCDNBZFKG-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO3S |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | 6-chloro-5-methoxypyridine-3-sulfonyl chloride |
| InChIKey | CZEMPZCDNBZFKG-UHFFFAOYSA-N |
| SMILES | COC1=C(N=CC(=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)