Products 6331-96-0
CAS 6331-96-0 appears in our catalog under these names: 2-Amino-4,5-dichlorobenzenesulfonic acid, 4，5–Dichloroaniline–2–sulfonic Acid, 2-Amino-4,5-dichlorobenzenesulfonic acid 98%, 2-Amino-4,5-dichlorobenzenesulfonic acid, 98%, 98%, 2-Amino-4,5-dichlorobenzenesulfonic acid, 98%. Offered by: Dr. Ehrenstorfer, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 1g, 5g.
2-amino-4,5-dichlorobenzenesulfonic acid (CAS 6331-96-0) is a chemical compound with the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. IUPAC name: 2-amino-4,5-dichlorobenzenesulfonic acid. InChIKey: AKLDPNVZTZIVFA-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO3S |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | 2-amino-4,5-dichlorobenzenesulfonic acid |
| InChIKey | AKLDPNVZTZIVFA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)S(=O)(=O)O)N |
Computed by PubChem (NCBI)