CAS 1208081-26-8 appears in our catalog under these names: 2–Chloro–6–methoxypyridine–3–sulfonyl chloride, 2-Chloro-6-methoxy-pyridine-3-sulfonyl chloride, 2-Chloro-6-methoxy-3-pyridinesulfonyl chloride, 95%+, 95%+, 2-Chloro-6-methoxy-pyridine-3-sulfonyl chloride, 95%+. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg.
2-chloro-6-methoxypyridine-3-sulfonyl chloride (CAS 1208081-26-8) is a chemical compound with the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. IUPAC name: 2-chloro-6-methoxypyridine-3-sulfonyl chloride. InChIKey: LPPWUEOVWSLMTH-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO3S |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | 2-chloro-6-methoxypyridine-3-sulfonyl chloride |
| InChIKey | LPPWUEOVWSLMTH-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)