Products 1261663-47-1
CAS 1261663-47-1 appears in our catalog under these names: 6-Chloro-2-methoxypyridine-3-sulfonyl chloride, 96%, 6-Chloro-2-methoxypyridine-3-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
6-chloro-2-methoxypyridine-3-sulfonyl chloride (CAS 1261663-47-1) is a chemical compound with the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. IUPAC name: 6-chloro-2-methoxypyridine-3-sulfonyl chloride. InChIKey: PGUKRCJUXXVSSR-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO3S |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | 6-chloro-2-methoxypyridine-3-sulfonyl chloride |
| InChIKey | PGUKRCJUXXVSSR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=N1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)