Products 1780989-06-1

CAS 1780989-06-1 is the registry number for 5-Chloro-1-methyl-2-oxo-1,2-dihydropyridine-3-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-chloro-1-methyl-2-oxopyridine-3-sulfonyl chloride (CAS 1780989-06-1) is a chemical compound with the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. IUPAC name: 5-chloro-1-methyl-2-oxopyridine-3-sulfonyl chloride. InChIKey: NYYANLWOBLLQIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5Cl2NO3S
Molecular weight242.08 g/mol
IUPAC name5-chloro-1-methyl-2-oxopyridine-3-sulfonyl chloride
InChIKeyNYYANLWOBLLQIZ-UHFFFAOYSA-N
SMILESCN1C=C(C=C(C1=O)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)