CAS 1499773-02-2 appears in our catalog under these names: 2,3-Dichloro-4-hydroxybenzenesulfonamide, 97%, 2,3-Dichloro-4-hydroxybenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,3-dichloro-4-hydroxybenzenesulfonamide (CAS 1499773-02-2) is a chemical compound with the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. IUPAC name: 2,3-dichloro-4-hydroxybenzenesulfonamide. InChIKey: OORXZCIRXHWOIV-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO3S |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | 2,3-dichloro-4-hydroxybenzenesulfonamide |
| InChIKey | OORXZCIRXHWOIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)Cl)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)