CAS 1261473-60-2 appears in our catalog under these names: 2-Bromo-3-cyanobenzoic acid, 2-Bromo-3-cyanobenzoic acid, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-bromo-3-cyanobenzoic acid (CAS 1261473-60-2) is a chemical compound with the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 2-bromo-3-cyanobenzoic acid. InChIKey: SDJYDHGPLAGKHH-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 2-bromo-3-cyanobenzoic acid |
| InChIKey | SDJYDHGPLAGKHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)O)Br)C#N |
Computed by PubChem (NCBI)