Products 1261573-60-7
CAS 1261573-60-7 appears in our catalog under these names: 2-Methyl-5-(trifluoromethoxy)benzyl bromide, 95%, 2-(Bromomethyl)-1-methyl-4-(trifluoromethoxy)benzene, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
2-(bromomethyl)-1-methyl-4-(trifluoromethoxy)benzene (CAS 1261573-60-7) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 2-(bromomethyl)-1-methyl-4-(trifluoromethoxy)benzene. InChIKey: BSYHAIGVGUZQGK-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 2-(bromomethyl)-1-methyl-4-(trifluoromethoxy)benzene |
| InChIKey | BSYHAIGVGUZQGK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC(F)(F)F)CBr |
Computed by PubChem (NCBI)