Products 1261587-55-6
CAS 1261587-55-6 appears in our catalog under these names: 2-Isocyanato-1-methoxy-4-(trifluoromethoxy)benzene 95%, 2-Isocyanato-1-methoxy-4-(trifluoromethoxy)benzene, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g.
2-isocyanato-1-methoxy-4-(trifluoromethoxy)benzene (CAS 1261587-55-6) is a chemical compound with the molecular formula C9H6F3NO3 and a molecular weight of 233.14 g/mol. IUPAC name: 2-isocyanato-1-methoxy-4-(trifluoromethoxy)benzene. InChIKey: UELSRQXMNHFYDW-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO3 |
|---|---|
| Molecular weight | 233.14 g/mol |
| IUPAC name | 2-isocyanato-1-methoxy-4-(trifluoromethoxy)benzene |
| InChIKey | UELSRQXMNHFYDW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)OC(F)(F)F)N=C=O |
Computed by PubChem (NCBI)