CAS 404-26-2 appears in our catalog under these names: 4-(Trifluoroacetylamino)benzoic Acid, 4-(2,2,2-Trifluoroacetamido)benzoic acid 95%, 4-(2,2,2-Trifluoroacetamido)benzoic acid, 98%, 98%, 4-[(trifluoroacetyl)amino]benzoic acid, 98%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
4-[(2,2,2-trifluoroacetyl)amino]benzoic acid (CAS 404-26-2) is a chemical compound with the molecular formula C9H6F3NO3 and a molecular weight of 233.14 g/mol. IUPAC name: 4-[(2,2,2-trifluoroacetyl)amino]benzoic acid. InChIKey: TZDURDLECJWHJD-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO3 |
|---|---|
| Molecular weight | 233.14 g/mol |
| IUPAC name | 4-[(2,2,2-trifluoroacetyl)amino]benzoic acid |
| InChIKey | TZDURDLECJWHJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)