CAS 2899205-62-8 is the registry number for 3-(6-Oxo-5-(trifluoromethyl)-1,6-dihydropyridin-3-yl)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[6-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]prop-2-enoic acid (CAS 2899205-62-8) is a chemical compound with the molecular formula C9H6F3NO3 and a molecular weight of 233.14 g/mol. IUPAC name: (E)-3-[6-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]prop-2-enoic acid. InChIKey: FEWRCXORJQRGSO-OWOJBTEDSA-N.
| Molecular formula | C9H6F3NO3 |
|---|---|
| Molecular weight | 233.14 g/mol |
| IUPAC name | (E)-3-[6-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]prop-2-enoic acid |
| InChIKey | FEWRCXORJQRGSO-OWOJBTEDSA-N |
| SMILES | C1=C(C(=O)NC=C1/C=C/C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)