CAS 69066-42-8 appears in our catalog under these names: Teriflunomide Impurity 2, 2-Oxo-2-((4-(trifluoromethyl)phenyl)amino)acetic Acid, 2-Oxo-2-[[4-(trifluoromethyl)phenyl]amino]acetic Acid, 98%, 98%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 1g, 100mg.
2-oxo-2-[4-(trifluoromethyl)anilino]acetic acid (CAS 69066-42-8) is a chemical compound with the molecular formula C9H6F3NO3 and a molecular weight of 233.14 g/mol. IUPAC name: 2-oxo-2-[4-(trifluoromethyl)anilino]acetic acid. InChIKey: WFZYVQMWEBADID-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO3 |
|---|---|
| Molecular weight | 233.14 g/mol |
| IUPAC name | 2-oxo-2-[4-(trifluoromethyl)anilino]acetic acid |
| InChIKey | WFZYVQMWEBADID-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)NC(=O)C(=O)O |
Computed by PubChem (NCBI)