Products 461426-32-4
CAS 461426-32-4 is the registry number for 4-(Trifluoroacetylamino)benzoic Acid-d4. Offered by: TRC. Available pack sizes: 10mg, 1mg.
2,3,5,6-tetradeuterio-4-[(2,2,2-trifluoroacetyl)amino]benzoic acid (CAS 461426-32-4) is a chemical compound with the molecular formula C9H6F3NO3 and a molecular weight of 237.17 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-[(2,2,2-trifluoroacetyl)amino]benzoic acid. InChIKey: TZDURDLECJWHJD-RHQRLBAQSA-N.
| Molecular formula | C9H6F3NO3 |
|---|---|
| Molecular weight | 237.17 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-[(2,2,2-trifluoroacetyl)amino]benzoic acid |
| InChIKey | TZDURDLECJWHJD-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])NC(=O)C(F)(F)F)[2H] |
Computed by PubChem (NCBI)