CAS 19165-29-8 appears in our catalog under these names: Sodium 2-[(trifluoroacetyl)amino]benzoate, 95%, 2-(Trifluoroacetamido)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 500mg.
2-[(2,2,2-trifluoroacetyl)amino]benzoic acid (CAS 19165-29-8) is a chemical compound with the molecular formula C9H6F3NO3 and a molecular weight of 233.14 g/mol. IUPAC name: 2-[(2,2,2-trifluoroacetyl)amino]benzoic acid. InChIKey: LAZKSSYOKYWMRN-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO3 |
|---|---|
| Molecular weight | 233.14 g/mol |
| IUPAC name | 2-[(2,2,2-trifluoroacetyl)amino]benzoic acid |
| InChIKey | LAZKSSYOKYWMRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)