CAS 1261729-44-5 is the registry number for ethyl 2-(3-iodophenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
Ethyl 2-(3-iodophenyl)-2-oxoacetate (CAS 1261729-44-5) is a chemical compound with the molecular formula C10H9IO3 and a molecular weight of 304.08 g/mol. IUPAC name: ethyl 2-(3-iodophenyl)-2-oxoacetate. InChIKey: KHJWMZMEKONQDH-UHFFFAOYSA-N.
| Molecular formula | C10H9IO3 |
|---|---|
| Molecular weight | 304.08 g/mol |
| IUPAC name | ethyl 2-(3-iodophenyl)-2-oxoacetate |
| InChIKey | KHJWMZMEKONQDH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC(=CC=C1)I |
Computed by PubChem (NCBI)