Products 1261815-87-5
CAS 1261815-87-5 appears in our catalog under these names: 2-(4-Bromo-3-hydroxyphenyl)acetic acid, 95+%, 2-(4-Bromo-3-hydroxyphenyl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(4-bromo-3-hydroxyphenyl)acetic acid (CAS 1261815-87-5) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(4-bromo-3-hydroxyphenyl)acetic acid. InChIKey: RMIUZKVIYWSGIS-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(4-bromo-3-hydroxyphenyl)acetic acid |
| InChIKey | RMIUZKVIYWSGIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)O)Br |
Computed by PubChem (NCBI)