Products 1261843-29-1
CAS 1261843-29-1 is the registry number for 5-Chloro-3-methoxy-2-pyridinesulfonyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-chloro-3-methoxypyridine-2-sulfonyl chloride (CAS 1261843-29-1) is a chemical compound with the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. IUPAC name: 5-chloro-3-methoxypyridine-2-sulfonyl chloride. InChIKey: SHKNLDFCTZQMCS-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO3S |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | 5-chloro-3-methoxypyridine-2-sulfonyl chloride |
| InChIKey | SHKNLDFCTZQMCS-UHFFFAOYSA-N |
| SMILES | COC1=C(N=CC(=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)