Products 1261938-18-4

CAS 1261938-18-4 is the registry number for 2-Chloro-4-(2-hydroxyphenyl)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-chloro-4-(2-hydroxyphenyl)benzoic acid (CAS 1261938-18-4) is a chemical compound with the molecular formula C13H9ClO3 and a molecular weight of 248.66 g/mol. IUPAC name: 2-chloro-4-(2-hydroxyphenyl)benzoic acid. InChIKey: NOFMDQISUTYLFX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9ClO3
Molecular weight248.66 g/mol
IUPAC name2-chloro-4-(2-hydroxyphenyl)benzoic acid
InChIKeyNOFMDQISUTYLFX-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC(=C(C=C2)C(=O)O)Cl)O

Computed by PubChem (NCBI)