Products 74917-55-8
CAS 74917-55-8 appears in our catalog under these names: 3-Chloro-4-phenoxybenzoic acid, 95%, 3-Chloro-4-phenoxybenzoic acid, ≥95%, ≥95%, 3-Chloro-4-phenoxybenzoic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
3-chloro-4-phenoxybenzoic acid (CAS 74917-55-8) is a chemical compound with the molecular formula C13H9ClO3 and a molecular weight of 248.66 g/mol. IUPAC name: 3-chloro-4-phenoxybenzoic acid. InChIKey: BHGHJIYJDMJREN-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO3 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 3-chloro-4-phenoxybenzoic acid |
| InChIKey | BHGHJIYJDMJREN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)