Products 613656-16-9

CAS 613656-16-9 is the registry number for 4-(2-Chlorophenoxy)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g.

Structural formula: {0} (CAS {1})

4-(2-chlorophenoxy)benzoic acid (CAS 613656-16-9) is a chemical compound with the molecular formula C13H9ClO3 and a molecular weight of 248.66 g/mol. IUPAC name: 4-(2-chlorophenoxy)benzoic acid. InChIKey: MVCATMWWLOULMN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9ClO3
Molecular weight248.66 g/mol
IUPAC name4-(2-chlorophenoxy)benzoic acid
InChIKeyMVCATMWWLOULMN-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)OC2=CC=C(C=C2)C(=O)O)Cl

Computed by PubChem (NCBI)