Products 36809-08-2
CAS 36809-08-2 appears in our catalog under these names: 2-(2-Chlorophenoxy)-benzoic acid, 95%, 2-(2-Chlorophenoxy)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-(2-chlorophenoxy)benzoic acid (CAS 36809-08-2) is a chemical compound with the molecular formula C13H9ClO3 and a molecular weight of 248.66 g/mol. IUPAC name: 2-(2-chlorophenoxy)benzoic acid. InChIKey: APMQHBOGXNKBHM-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO3 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 2-(2-chlorophenoxy)benzoic acid |
| InChIKey | APMQHBOGXNKBHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)