CAS 376592-57-3 appears in our catalog under these names: 5'-Chloro-2'-hydroxy-[1,1'-biphenyl]-3-carboxylic acid, 95%, Eltrombopag Impurity 29. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
3-(5-chloro-2-hydroxyphenyl)benzoic acid (CAS 376592-57-3) is a chemical compound with the molecular formula C13H9ClO3 and a molecular weight of 248.66 g/mol. IUPAC name: 3-(5-chloro-2-hydroxyphenyl)benzoic acid. InChIKey: ODGCLNKGAPCIAE-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO3 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 3-(5-chloro-2-hydroxyphenyl)benzoic acid |
| InChIKey | ODGCLNKGAPCIAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=C(C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)