Products 214690-17-2
CAS 214690-17-2 is the registry number for 4-Phenoxyphenyl carbonochloridate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-phenoxyphenyl) carbonochloridate (CAS 214690-17-2) is a chemical compound with the molecular formula C13H9ClO3 and a molecular weight of 248.66 g/mol. IUPAC name: (4-phenoxyphenyl) carbonochloridate. InChIKey: PCDPTWCVIJHTCD-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO3 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | (4-phenoxyphenyl) carbonochloridate |
| InChIKey | PCDPTWCVIJHTCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)OC(=O)Cl |
Computed by PubChem (NCBI)