CAS 197847-94-2 appears in our catalog under these names: 6–(2–(Trifluoromethoxy)phenyl)nicotinic Acid, 6-[2-(TRIFLUOROMETHOXY)PHENYL]NICOTINIC ACID, 6-(2-(Trifluoromethoxy)phenyl)nicotinic acid, 95%, 6-(2-(Trifluoromethoxy)phenyl)nicotinic acid, >95%, >95%. Offered by: GLPBio, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
6-[2-(trifluoromethoxy)phenyl]pyridine-3-carboxylic acid (CAS 197847-94-2) is a chemical compound with the molecular formula C13H8F3NO3 and a molecular weight of 283.20 g/mol. IUPAC name: 6-[2-(trifluoromethoxy)phenyl]pyridine-3-carboxylic acid. InChIKey: UZTLKBORYPDIRC-UHFFFAOYSA-N.
| Molecular formula | C13H8F3NO3 |
|---|---|
| Molecular weight | 283.20 g/mol |
| IUPAC name | 6-[2-(trifluoromethoxy)phenyl]pyridine-3-carboxylic acid |
| InChIKey | UZTLKBORYPDIRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=C(C=C2)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)