Products 1261997-49-2

CAS 1261997-49-2 is the registry number for 3-(3-Aminocarbonylphenyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

3-(3-carbamoylphenyl)benzoic acid (CAS 1261997-49-2) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: 3-(3-carbamoylphenyl)benzoic acid. InChIKey: PIFZQEAEPZKVIE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11NO3
Molecular weight241.24 g/mol
IUPAC name3-(3-carbamoylphenyl)benzoic acid
InChIKeyPIFZQEAEPZKVIE-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)N)C2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)