CAS 1261998-46-2 appears in our catalog under these names: 4-(4-Chloro-3-methoxycarbonylphenyl)benzoic acid, 96%, 4'-Chloro-3'-(methoxycarbonyl)-(1,1'-biphenyl)-4-carboxylic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
4-(4-chloro-3-methoxycarbonylphenyl)benzoic acid (CAS 1261998-46-2) is a chemical compound with the molecular formula C15H11ClO4 and a molecular weight of 290.70 g/mol. IUPAC name: 4-(4-chloro-3-methoxycarbonylphenyl)benzoic acid. InChIKey: QAXFNLFHPDFVJL-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO4 |
|---|---|
| Molecular weight | 290.70 g/mol |
| IUPAC name | 4-(4-chloro-3-methoxycarbonylphenyl)benzoic acid |
| InChIKey | QAXFNLFHPDFVJL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C2=CC=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)