Products 429623-19-8

CAS 429623-19-8 is the registry number for 3-((2-Chloro-4-formylphenoxy)methyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[(2-chloro-4-formylphenoxy)methyl]benzoic acid (CAS 429623-19-8) is a chemical compound with the molecular formula C15H11ClO4 and a molecular weight of 290.70 g/mol. IUPAC name: 3-[(2-chloro-4-formylphenoxy)methyl]benzoic acid. InChIKey: VXMPHQJQPBSBLV-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11ClO4
Molecular weight290.70 g/mol
IUPAC name3-[(2-chloro-4-formylphenoxy)methyl]benzoic acid
InChIKeyVXMPHQJQPBSBLV-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)COC2=C(C=C(C=C2)C=O)Cl

Computed by PubChem (NCBI)