CAS 321726-57-2 appears in our catalog under these names: 4-Formyl-2-methoxyphenyl 4-chlorobenzoate, 95%, 4-Formyl-2-methoxyphenyl 4-chlorobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(4-formyl-2-methoxyphenyl) 4-chlorobenzoate (CAS 321726-57-2) is a chemical compound with the molecular formula C15H11ClO4 and a molecular weight of 290.70 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) 4-chlorobenzoate. InChIKey: TUSSATZPNQQXSX-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO4 |
|---|---|
| Molecular weight | 290.70 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) 4-chlorobenzoate |
| InChIKey | TUSSATZPNQQXSX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)