Products 1820703-97-6
CAS 1820703-97-6 is the registry number for methyl 3-(2H-1,3-benzodioxol-5-yl)-4-chlorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 3-(1,3-benzodioxol-5-yl)-4-chlorobenzoate (CAS 1820703-97-6) is a chemical compound with the molecular formula C15H11ClO4 and a molecular weight of 290.70 g/mol. IUPAC name: methyl 3-(1,3-benzodioxol-5-yl)-4-chlorobenzoate. InChIKey: NKCGFYMZEHUJPB-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO4 |
|---|---|
| Molecular weight | 290.70 g/mol |
| IUPAC name | methyl 3-(1,3-benzodioxol-5-yl)-4-chlorobenzoate |
| InChIKey | NKCGFYMZEHUJPB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Cl)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)