CAS 321726-59-4 is the registry number for 4-Formyl-2-methoxyphenyl 2-chlorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(4-formyl-2-methoxyphenyl) 2-chlorobenzoate (CAS 321726-59-4) is a chemical compound with the molecular formula C15H11ClO4 and a molecular weight of 290.70 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) 2-chlorobenzoate. InChIKey: PXMDYNSNBXIDHA-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO4 |
|---|---|
| Molecular weight | 290.70 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) 2-chlorobenzoate |
| InChIKey | PXMDYNSNBXIDHA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OC(=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)