CAS 158425-76-4 is the registry number for 2-(3-Chloro-4-methoxybenzoyl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3-chloro-4-methoxybenzoyl)benzoic acid (CAS 158425-76-4) is a chemical compound with the molecular formula C15H11ClO4 and a molecular weight of 290.70 g/mol. IUPAC name: 2-(3-chloro-4-methoxybenzoyl)benzoic acid. InChIKey: ICYJHSUTKRAUMS-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO4 |
|---|---|
| Molecular weight | 290.70 g/mol |
| IUPAC name | 2-(3-chloro-4-methoxybenzoyl)benzoic acid |
| InChIKey | ICYJHSUTKRAUMS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2C(=O)O)Cl |
Computed by PubChem (NCBI)