CAS 1262003-63-3 is the registry number for 2-Cyano-5-(2,4-dimethoxyphenyl)phenol. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
4-(2,4-dimethoxyphenyl)-2-hydroxybenzonitrile (CAS 1262003-63-3) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 4-(2,4-dimethoxyphenyl)-2-hydroxybenzonitrile. InChIKey: ARFBEQSLQCAVGJ-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 4-(2,4-dimethoxyphenyl)-2-hydroxybenzonitrile |
| InChIKey | ARFBEQSLQCAVGJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=CC(=C(C=C2)C#N)O)OC |
Computed by PubChem (NCBI)