CAS 1262003-94-0 is the registry number for 5-(3,5-Dichlorophenyl)-2-formylphenol, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(3,5-dichlorophenyl)-2-hydroxybenzaldehyde (CAS 1262003-94-0) is a chemical compound with the molecular formula C13H8Cl2O2 and a molecular weight of 267.10 g/mol. IUPAC name: 4-(3,5-dichlorophenyl)-2-hydroxybenzaldehyde. InChIKey: UINBBHZVOIADCN-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O2 |
|---|---|
| Molecular weight | 267.10 g/mol |
| IUPAC name | 4-(3,5-dichlorophenyl)-2-hydroxybenzaldehyde |
| InChIKey | UINBBHZVOIADCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=CC(=C2)Cl)Cl)O)C=O |
Computed by PubChem (NCBI)