Products 1262769-94-7

CAS 1262769-94-7 is the registry number for 3,3-Diethyl 3,3-oxetanediacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-[3-(2-ethoxy-2-oxoethyl)oxetan-3-yl]acetate (CAS 1262769-94-7) is a chemical compound with the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. IUPAC name: ethyl 2-[3-(2-ethoxy-2-oxoethyl)oxetan-3-yl]acetate. InChIKey: NTDTTXWHMNHYOA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18O5
Molecular weight230.26 g/mol
IUPAC nameethyl 2-[3-(2-ethoxy-2-oxoethyl)oxetan-3-yl]acetate
InChIKeyNTDTTXWHMNHYOA-UHFFFAOYSA-N
SMILESCCOC(=O)CC1(COC1)CC(=O)OCC

Computed by PubChem (NCBI)