Products 1262795-35-6
CAS 1262795-35-6 is the registry number for Stiripentol Impurity 2-d9. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1-(1,3-benzodioxol-5-yl)-5,5,5-trideuterio-4,4-bis(trideuteriomethyl)pent-1-en-3-one (CAS 1262795-35-6) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 241.33 g/mol. IUPAC name: (E)-1-(1,3-benzodioxol-5-yl)-5,5,5-trideuterio-4,4-bis(trideuteriomethyl)pent-1-en-3-one. InChIKey: LXFNQCGNCFRKRR-QPYRMXHWSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | (E)-1-(1,3-benzodioxol-5-yl)-5,5,5-trideuterio-4,4-bis(trideuteriomethyl)pent-1-en-3-one |
| InChIKey | LXFNQCGNCFRKRR-QPYRMXHWSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)/C=C/C1=CC2=C(C=C1)OCO2)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)