CAS 144850-45-3 appears in our catalog under these names: 3-Deshydroxy 3-Keto Stiripentol, Stiripentol Impurity 6, Stiripentol Impurity 2. Offered by: TRC, Chemat Brand. Available pack sizes: 1g, on request.
(E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-one (CAS 144850-45-3) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: (E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-one. InChIKey: LXFNQCGNCFRKRR-FNORWQNLSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | (E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-one |
| InChIKey | LXFNQCGNCFRKRR-FNORWQNLSA-N |
| SMILES | CC(C)(C)C(=O)/C=C/C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)