Products 1263276-48-7
CAS 1263276-48-7 is the registry number for 2,2-Dimethylchromane-6-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dimethyl-3,4-dihydrochromene-6-sulfonamide (CAS 1263276-48-7) is a chemical compound with the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. IUPAC name: 2,2-dimethyl-3,4-dihydrochromene-6-sulfonamide. InChIKey: BZDQWXXADZWALP-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 2,2-dimethyl-3,4-dihydrochromene-6-sulfonamide |
| InChIKey | BZDQWXXADZWALP-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C=CC(=C2)S(=O)(=O)N)C |
Computed by PubChem (NCBI)