CAS 1263313-09-2 is the registry number for t-Butyl 4-(trifluoromethoxy)phenyl ketone, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,2-dimethyl-1-[4-(trifluoromethoxy)phenyl]propan-1-one (CAS 1263313-09-2) is a chemical compound with the molecular formula C12H13F3O2 and a molecular weight of 246.22 g/mol. IUPAC name: 2,2-dimethyl-1-[4-(trifluoromethoxy)phenyl]propan-1-one. InChIKey: VTGSZGVSKUSSMP-UHFFFAOYSA-N.
| Molecular formula | C12H13F3O2 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 2,2-dimethyl-1-[4-(trifluoromethoxy)phenyl]propan-1-one |
| InChIKey | VTGSZGVSKUSSMP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC=C(C=C1)OC(F)(F)F |
Computed by PubChem (NCBI)