CAS 2892313-98-1 is the registry number for Benzyl (R)-4,4,4-trifluoro-3-methylbutanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (3R)-4,4,4-trifluoro-3-methylbutanoate (CAS 2892313-98-1) is a chemical compound with the molecular formula C12H13F3O2 and a molecular weight of 246.22 g/mol. IUPAC name: benzyl (3R)-4,4,4-trifluoro-3-methylbutanoate. InChIKey: SJQJALUQURRKHJ-SECBINFHSA-N.
| Molecular formula | C12H13F3O2 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | benzyl (3R)-4,4,4-trifluoro-3-methylbutanoate |
| InChIKey | SJQJALUQURRKHJ-SECBINFHSA-N |
| SMILES | C[C@H](CC(=O)OCC1=CC=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)