Products 2568008-39-7

CAS 2568008-39-7 is the registry number for 2-(3-Isopropyl-5-(trifluoromethyl)phenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[3-propan-2-yl-5-(trifluoromethyl)phenyl]acetic acid (CAS 2568008-39-7) is a chemical compound with the molecular formula C12H13F3O2 and a molecular weight of 246.22 g/mol. IUPAC name: 2-[3-propan-2-yl-5-(trifluoromethyl)phenyl]acetic acid. InChIKey: GQAXCWZQUWGIAA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13F3O2
Molecular weight246.22 g/mol
IUPAC name2-[3-propan-2-yl-5-(trifluoromethyl)phenyl]acetic acid
InChIKeyGQAXCWZQUWGIAA-UHFFFAOYSA-N
SMILESCC(C)C1=CC(=CC(=C1)CC(=O)O)C(F)(F)F

Computed by PubChem (NCBI)