Products 2848722-30-3
CAS 2848722-30-3 is the registry number for Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[4-(1,1-difluoroethyl)-3-fluorophenyl]acetate (CAS 2848722-30-3) is a chemical compound with the molecular formula C12H13F3O2 and a molecular weight of 246.22 g/mol. IUPAC name: ethyl 2-[4-(1,1-difluoroethyl)-3-fluorophenyl]acetate. InChIKey: JIUFNQBIOHUNHL-UHFFFAOYSA-N.
| Molecular formula | C12H13F3O2 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | ethyl 2-[4-(1,1-difluoroethyl)-3-fluorophenyl]acetate |
| InChIKey | JIUFNQBIOHUNHL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC(=C(C=C1)C(C)(F)F)F |
Computed by PubChem (NCBI)