Products 70311-33-0

CAS 70311-33-0 is the registry number for Ethyl 3-(3-trifluoromethylphenyl) Propanoate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 3-[3-(trifluoromethyl)phenyl]propanoate (CAS 70311-33-0) is a chemical compound with the molecular formula C12H13F3O2 and a molecular weight of 246.22 g/mol. IUPAC name: ethyl 3-[3-(trifluoromethyl)phenyl]propanoate. InChIKey: OUHPHSYPKKLTKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13F3O2
Molecular weight246.22 g/mol
IUPAC nameethyl 3-[3-(trifluoromethyl)phenyl]propanoate
InChIKeyOUHPHSYPKKLTKJ-UHFFFAOYSA-N
SMILESCCOC(=O)CCC1=CC(=CC=C1)C(F)(F)F

Computed by PubChem (NCBI)