CAS 1518241-73-0 appears in our catalog under these names: 3-Methyl-3-[2-(trifluoromethyl)phenyl]butanoic acid, 95%, 3-Methyl-3-(2-(trifluoromethyl)phenyl)butanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
3-methyl-3-[2-(trifluoromethyl)phenyl]butanoic acid (CAS 1518241-73-0) is a chemical compound with the molecular formula C12H13F3O2 and a molecular weight of 246.22 g/mol. IUPAC name: 3-methyl-3-[2-(trifluoromethyl)phenyl]butanoic acid. InChIKey: MVXGRVBZNDYMLM-UHFFFAOYSA-N.
| Molecular formula | C12H13F3O2 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 3-methyl-3-[2-(trifluoromethyl)phenyl]butanoic acid |
| InChIKey | MVXGRVBZNDYMLM-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)O)C1=CC=CC=C1C(F)(F)F |
Computed by PubChem (NCBI)